1-aminotetradecanone
CAS No: 71412-11-8
71415-85-5
4-Amino-3-O-[(2S)-3α-amino-6-[(S)-1-aminoethyl]-3,4-dihydro-2H-pyran-2α-yl]-1,4-dideoxy-6-O-methyl-1-(methylamino)-L-chiro-inositol
71412-01-6
4-amino(phenylazo)naphthalene-1-sulphonic acid
71418-44-5
Monobromobimane (mBBr)
71413-14-4
Carbamic acid, [1-formyl-4-[[imino(nitroamino)methyl]amino]butyl]-,1,1-dimethylethyl ester, (S)-
71415-74-2
(5Z,7E)-3β-Hydroxy-9,10-secochola-5,7,10(19)-trien-24-oic acid
71412-07-2
7-amino-(4-aminophenyl)-4-hydroxynaphthalene-2-sulphonic acid
71418-33-2
S-(3-sulfopropyl)cysteine
71416-18-7
1-Cyclohexene-1,2-dicarboxamide,N-(4-chloro-2-fluorophenyl)-N'-ethyl-
71412-11-8
1-aminotetradecanone
71412-21-0
3,4-dihydro-6-(isopropyl)-3-[4-(isopropyl)phenyl]quinazoline
714189-46-5
3-Penten-2-one,4-hydroxy-5-methoxy-
71416-17-6
1-Cyclohexene-1,2-dicarboxamide,N-(4-chloro-2-fluorophenyl)-N'-methyl-
71416-65-4
1-Cyclohexene-1,2-dicarboxamide, N-(4-chloro-2-fluorophenyl)-
714192-66-2
CYCLOPENTANECARBOXYLIC ACID,2-(AMINOCARBONYL)-,(1R,2S)-REL-(-)-
71412-26-5
2,3-dimethylbutyl acetate
7141-22-2
8-BROMO-9-CHLORODODEC-1-ENE
71412-83-4
6-Phenyl-2,5,7,10-tetraoxaundecane
714188-19-9
1H-Imidazole-5-ethanamine,N-methyl-4-propyl-
714194-19-1
2-FURANACETIC ACID,A-AMINOTETRAHYDRO-5-OXO-,(AR,2R)-REL-
71412-02-7
(aminomethyl)cyclohexan-1-ol
71412-11-8
aminotetradecanone,71412-11-8
2025-10-17 Discover 1-aminotetradecanone (CAS No: 71412-11-8) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.